C20H29N3O2 — CID 155504395
2,2-dimethyl-N-[[(1S,5S,6R,7R)-3-(3-methyl-4-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide (PubChem CID 155504395) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2,2-dimethyl-N-[[(1S,5S,6R,7R)-3-(3-methyl-4-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[[(1S,5S,6R,7R)-3-(3-methyl-4-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide |
|---|---|
| PubChem CID | 155504395 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2,2-dimethyl-N-[[(1S,5S,6R,7R)-3-(3-methyl-4-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide |
| SMILES | Cc1cnccc1N1C[C@@H]2[C@H](CNC(=O)C(C)(C)C)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C20H29N3O2/c1-13-9-21-8-6-16(13)23-11-15-14(10-22-18(24)19(2,3)4)17-5-7-20(15,12-23)25-17/h6,8-9,14-15,17H,5,7,10-12H2,1-4H3,(H,22,24)/t14-,15+,17+,20+/m0/s1 |
| InChIKey | HUMBSGAGUBIVCL-DKYLXPRQSA-N |
| XLogP | 2.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |