C20H26N6O4 — CID 155504707
(6S,7S,8aS)-6-ethyl-2-(imidazo[1,2-b]pyridazine-3-carbonyl)-N-(2-methoxyethyl)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 155504707) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is (6S,7S,8aS)-6-ethyl-2-(imidazo[1,2-b]pyridazine-3-carbonyl)-N-(2-methoxyethyl)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (6S,7S,8aS)-6-ethyl-2-(imidazo[1,2-b]pyridazine-3-carbonyl)-N-(2-methoxyethyl)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 155504707 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (6S,7S,8aS)-6-ethyl-2-(imidazo[1,2-b]pyridazine-3-carbonyl)-N-(2-methoxyethyl)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC[C@H]1[C@@H](C(=O)NCCOC)C[C@H]2CN(C(=O)c3cnc4cccnn34)CC(=O)N21 |
| InChI | InChI=1S/C20H26N6O4/c1-3-15-14(19(28)21-7-8-30-2)9-13-11-24(12-18(27)25(13)15)20(29)16-10-22-17-5-4-6-23-26(16)17/h4-6,10,13-15H,3,7-9,11-12H2,1-2H3,(H,21,28)/t13-,14-,15-/m0/s1 |
| InChIKey | WUANMMXSDXLCCY-KKUMJFAQSA-N |
| XLogP | -0.06 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|