C15H20N4OS — CID 155504791
(3R,7R,8aS)-3-methyl-N-(7-methylthieno[3,2-d]pyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine (PubChem CID 155504791) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is (3R,7R,8aS)-3-methyl-N-(7-methylthieno[3,2-d]pyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine.
| Compound Name | (3R,7R,8aS)-3-methyl-N-(7-methylthieno[3,2-d]pyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
|---|---|
| PubChem CID | 155504791 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (3R,7R,8aS)-3-methyl-N-(7-methylthieno[3,2-d]pyrimidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
| SMILES | Cc1csc2c(N[C@@H]3C[C@H]4CO[C@H](C)CN4C3)ncnc12 |
| InChI | InChI=1S/C15H20N4OS/c1-9-7-21-14-13(9)16-8-17-15(14)18-11-3-12-6-20-10(2)4-19(12)5-11/h7-8,10-12H,3-6H2,1-2H3,(H,16,17,18)/t10-,11-,12+/m1/s1 |
| InChIKey | GNDIGVYCTDBLJZ-UTUOFQBUSA-N |
| XLogP | 2.27 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |