C21H20N2O4 — CID 155505387
4-[(2R,3S)-2-(hydroxymethyl)-3-phenylmorpholine-4-carbonyl]-1H-quinolin-2-one (PubChem CID 155505387) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-[(2R,3S)-2-(hydroxymethyl)-3-phenylmorpholine-4-carbonyl]-1H-quinolin-2-one.
| Compound Name | 4-[(2R,3S)-2-(hydroxymethyl)-3-phenylmorpholine-4-carbonyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 155505387 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 4-[(2R,3S)-2-(hydroxymethyl)-3-phenylmorpholine-4-carbonyl]-1H-quinolin-2-one |
| SMILES | O=C(c1cc(=O)[nH]c2ccccc12)N1CCO[C@@H](CO)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H20N2O4/c24-13-18-20(14-6-2-1-3-7-14)23(10-11-27-18)21(26)16-12-19(25)22-17-9-5-4-8-15(16)17/h1-9,12,18,20,24H,10-11,13H2,(H,22,25)/t18-,20-/m0/s1 |
| InChIKey | JDUROUNYKJYICQ-ICSRJNTNSA-N |
| XLogP | 2.10 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |