C22H29NO3S — CID 155505536
(2S,6R)-4-[2-(benzenesulfonyl)ethyl]-2-tert-butyl-6-phenylmorpholine (PubChem CID 155505536) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is (2S,6R)-4-[2-(benzenesulfonyl)ethyl]-2-tert-butyl-6-phenylmorpholine.
| Compound Name | (2S,6R)-4-[2-(benzenesulfonyl)ethyl]-2-tert-butyl-6-phenylmorpholine |
|---|---|
| PubChem CID | 155505536 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (2S,6R)-4-[2-(benzenesulfonyl)ethyl]-2-tert-butyl-6-phenylmorpholine |
| SMILES | CC(C)(C)[C@H]1CN(CCS(=O)(=O)c2ccccc2)C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C22H29NO3S/c1-22(2,3)21-17-23(16-20(26-21)18-10-6-4-7-11-18)14-15-27(24,25)19-12-8-5-9-13-19/h4-13,20-21H,14-17H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | ZMJWFCJNDNJNNG-LEWJYISDSA-N |
| XLogP | 3.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |