C21H34N4O2 — CID 155506093
N-[[(1S,5S,6R,7R)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-ethylbutanamide (PubChem CID 155506093) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-ethylbutanamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 155506093 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NC[C@H]1[C@H]2CN(Cc3c(C)n[nH]c3C)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C21H34N4O2/c1-5-15(6-2)20(26)22-9-16-18-11-25(10-17-13(3)23-24-14(17)4)12-21(18)8-7-19(16)27-21/h15-16,18-19H,5-12H2,1-4H3,(H,22,26)(H,23,24)/t16-,18+,19+,21+/m0/s1 |
| InChIKey | JMKFQICGWASFHW-HKJQZYRSSA-N |
| XLogP | 2.56 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |