C12H15F3N6 — CID 155506513
2-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine (PubChem CID 155506513) has the molecular formula C12H15F3N6 and a molecular weight of 300.29 g/mol. Its IUPAC name is 2-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine.
| Compound Name | 2-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine |
|---|---|
| PubChem CID | 155506513 |
| Molecular Formula | C12H15F3N6 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine |
| SMILES | Cc1nc(-c2cn3c(n2)CCNCC3)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H15F3N6/c1-8-17-11(21(19-8)7-12(13,14)15)9-6-20-5-4-16-3-2-10(20)18-9/h6,16H,2-5,7H2,1H3 |
| InChIKey | ZKJGTXVHQXVFDJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |