About 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide
2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide (PubChem CID 155506777) has the molecular formula C18H28N2O4
and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide |
| PubChem CID | 155506777 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide |
| SMILES | COCCC[C@@]1(CO)CN(CC(=O)Nc2ccccc2)CC[C@H]1O |
| InChI | InChI=1S/C18H28N2O4/c1-24-11-5-9-18(14-21)13-20(10-8-16(18)22)12-17(23)19-15-6-3-2-4-7-15/h2-4,6-7,16,21-22H,5,8-14H2,1H3,(H,19,23)/t16-,18+/m1/s1 |
| InChIKey | LLFZYXSVAIIDPQ-AEFFLSMTSA-N |
| XLogP | 1.10 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide?
The IUPAC name of 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide (CID 155506777) is 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide.
What is the SMILES notation for 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide?
The canonical SMILES for 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide is COCCC[C@@]1(CO)CN(CC(=O)Nc2ccccc2)CC[C@H]1O.
What is the InChIKey of 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide?
The InChIKey is LLFZYXSVAIIDPQ-AEFFLSMTSA-N. The full InChI is InChI=1S/C18H28N2O4/c1-24-11-5-9-18(14-21)13-20(10-8-16(18)22)12-17(23)19-15-6-3-2-4-7-15/h2-4,6-7,16,21-22H,5,8-14H2,1H3,(H,19,23)/t16-,18+/m1/s1.
What are the key properties of 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide?
2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide has a molecular weight of 336.43 g/mol, XLogP of 1.10, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-N-phenylacetamide is sourced from PubChem (CID 155506777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).