C22H32N2O3 — CID 155506870
(5aS,8aS)-7-[4-(4-tert-butylphenyl)-4-oxobutyl]-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one (PubChem CID 155506870) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is (5aS,8aS)-7-[4-(4-tert-butylphenyl)-4-oxobutyl]-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one.
| Compound Name | (5aS,8aS)-7-[4-(4-tert-butylphenyl)-4-oxobutyl]-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one |
|---|---|
| PubChem CID | 155506870 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | (5aS,8aS)-7-[4-(4-tert-butylphenyl)-4-oxobutyl]-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one |
| SMILES | CN1C(=O)CCO[C@H]2CN(CCCC(=O)c3ccc(C(C)(C)C)cc3)C[C@@H]21 |
| InChI | InChI=1S/C22H32N2O3/c1-22(2,3)17-9-7-16(8-10-17)19(25)6-5-12-24-14-18-20(15-24)27-13-11-21(26)23(18)4/h7-10,18,20H,5-6,11-15H2,1-4H3/t18-,20-/m0/s1 |
| InChIKey | GXRFXLPWIQWONM-ICSRJNTNSA-N |
| XLogP | 2.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |