C13H20F3N5O2 — CID 155507538
2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-N-methylacetamide (PubChem CID 155507538) has the molecular formula C13H20F3N5O2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-N-methylacetamide.
| Compound Name | 2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 155507538 |
| Molecular Formula | C13H20F3N5O2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1nc([C@H]2CC[C@@H](O)[C@H](N)C2)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C13H20F3N5O2/c1-18-11(23)5-10-19-12(21(20-10)6-13(14,15)16)7-2-3-9(22)8(17)4-7/h7-9,22H,2-6,17H2,1H3,(H,18,23)/t7-,8+,9+/m0/s1 |
| InChIKey | JQYRNXOYQPHJBX-DJLDLDEBSA-N |
| XLogP | 0.08 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |