C21H29N3O4 — CID 155507548
4-[(1S,5S,6R,7R)-6-[(hexanoylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]pyridine-2-carboxylic acid (PubChem CID 155507548) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-[(1S,5S,6R,7R)-6-[(hexanoylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]pyridine-2-carboxylic acid.
| Compound Name | 4-[(1S,5S,6R,7R)-6-[(hexanoylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 155507548 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 4-[(1S,5S,6R,7R)-6-[(hexanoylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]pyridine-2-carboxylic acid |
| SMILES | CCCCCC(=O)NC[C@H]1[C@H]2CN(c3ccnc(C(=O)O)c3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C21H29N3O4/c1-2-3-4-5-19(25)23-11-15-16-12-24(13-21(16)8-6-18(15)28-21)14-7-9-22-17(10-14)20(26)27/h7,9-10,15-16,18H,2-6,8,11-13H2,1H3,(H,23,25)(H,26,27)/t15-,16+,18+,21+/m0/s1 |
| InChIKey | OIVWBUBNYJNOJQ-LTVCHDBBSA-N |
| XLogP | 2.46 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|