C27H28N2O2S — CID 15550783
4-(benzenesulfinyl)-N-[2-(1-benzylindol-3-yl)ethyl]butanamide (PubChem CID 15550783) has the molecular formula C27H28N2O2S and a molecular weight of 444.60 g/mol. Its IUPAC name is 4-(benzenesulfinyl)-N-[2-(1-benzylindol-3-yl)ethyl]butanamide.
| Compound Name | 4-(benzenesulfinyl)-N-[2-(1-benzylindol-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 15550783 |
| Molecular Formula | C27H28N2O2S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 4-(benzenesulfinyl)-N-[2-(1-benzylindol-3-yl)ethyl]butanamide |
| SMILES | O=C(CCCS(=O)c1ccccc1)NCCc1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C27H28N2O2S/c30-27(16-9-19-32(31)24-12-5-2-6-13-24)28-18-17-23-21-29(20-22-10-3-1-4-11-22)26-15-8-7-14-25(23)26/h1-8,10-15,21H,9,16-20H2,(H,28,30) |
| InChIKey | MKCQOQGTGYOLAN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |