C21H27N3O2 — CID 155509197
[(1S,5S,6R,7R)-3-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol (PubChem CID 155509197) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is [(1S,5S,6R,7R)-3-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol.
| Compound Name | [(1S,5S,6R,7R)-3-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
|---|---|
| PubChem CID | 155509197 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | [(1S,5S,6R,7R)-3-[[3-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
| SMILES | Cc1cc(C)n(-c2cccc(CN3C[C@@H]4[C@H](CO)[C@H]5CC[C@]4(C3)O5)c2)n1 |
| InChI | InChI=1S/C21H27N3O2/c1-14-8-15(2)24(22-14)17-5-3-4-16(9-17)10-23-11-19-18(12-25)20-6-7-21(19,13-23)26-20/h3-5,8-9,18-20,25H,6-7,10-13H2,1-2H3/t18-,19+,20+,21+/m0/s1 |
| InChIKey | PPOAOBCKFBOHJO-DOIPELPJSA-N |
| XLogP | 2.46 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |