C22H30N2O4 — CID 155509269
3-[(1S,5S,6R,7R)-6-[[[2-(3,5-dimethylphenyl)acetyl]amino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]propanoic acid (PubChem CID 155509269) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 3-[(1S,5S,6R,7R)-6-[[[2-(3,5-dimethylphenyl)acetyl]amino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]propanoic acid.
| Compound Name | 3-[(1S,5S,6R,7R)-6-[[[2-(3,5-dimethylphenyl)acetyl]amino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 155509269 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 3-[(1S,5S,6R,7R)-6-[[[2-(3,5-dimethylphenyl)acetyl]amino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]propanoic acid |
| SMILES | Cc1cc(C)cc(CC(=O)NC[C@H]2[C@H]3CN(CCC(=O)O)C[C@]34CC[C@H]2O4)c1 |
| InChI | InChI=1S/C22H30N2O4/c1-14-7-15(2)9-16(8-14)10-20(25)23-11-17-18-12-24(6-4-21(26)27)13-22(18)5-3-19(17)28-22/h7-9,17-19H,3-6,10-13H2,1-2H3,(H,23,25)(H,26,27)/t17-,18+,19+,22+/m0/s1 |
| InChIKey | ZSBBSHBYFIUSLJ-JZJXAQOMSA-N |
| XLogP | 1.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |