C25H33N3O — CID 155509582
(3S,7R,8aS)-N-[1-(2-methylphenyl)piperidin-4-yl]-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine (PubChem CID 155509582) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is (3S,7R,8aS)-N-[1-(2-methylphenyl)piperidin-4-yl]-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine.
| Compound Name | (3S,7R,8aS)-N-[1-(2-methylphenyl)piperidin-4-yl]-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
|---|---|
| PubChem CID | 155509582 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | (3S,7R,8aS)-N-[1-(2-methylphenyl)piperidin-4-yl]-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
| SMILES | Cc1ccccc1N1CCC(N[C@@H]2C[C@H]3CO[C@@H](c4ccccc4)CN3C2)CC1 |
| InChI | InChI=1S/C25H33N3O/c1-19-7-5-6-10-24(19)27-13-11-21(12-14-27)26-22-15-23-18-29-25(17-28(23)16-22)20-8-3-2-4-9-20/h2-10,21-23,25-26H,11-18H2,1H3/t22-,23+,25-/m1/s1 |
| InChIKey | HXEALIAJBXLFCJ-GIFXNVAJSA-N |
| XLogP | 3.77 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |