About methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate
methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate (PubChem CID 155510008) has the molecular formula C20H31NO3
and a molecular weight of 333.47 g/mol. Its IUPAC name is methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate.
Molecular Properties
| Compound Name | methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate |
| PubChem CID | 155510008 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C[C@@H](c2ccccc2)O[C@@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C20H31NO3/c1-20(2,3)18-15-21(13-9-8-12-19(22)23-4)14-17(24-18)16-10-6-5-7-11-16/h5-7,10-11,17-18H,8-9,12-15H2,1-4H3/t17-,18+/m0/s1 |
| InChIKey | CIZDZQQCMFCHMM-ZWKOTPCHSA-N |
| XLogP | 3.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate?
The IUPAC name of methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate (CID 155510008) is methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate.
What is the SMILES notation for methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate?
The canonical SMILES for methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate is COC(=O)CCCCN1C[C@@H](c2ccccc2)O[C@@H](C(C)(C)C)C1.
What is the InChIKey of methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate?
The InChIKey is CIZDZQQCMFCHMM-ZWKOTPCHSA-N. The full InChI is InChI=1S/C20H31NO3/c1-20(2,3)18-15-21(13-9-8-12-19(22)23-4)14-17(24-18)16-10-6-5-7-11-16/h5-7,10-11,17-18H,8-9,12-15H2,1-4H3/t17-,18+/m0/s1.
What are the key properties of methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate?
methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate has a molecular weight of 333.47 g/mol, XLogP of 3.82, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]pentanoate is sourced from PubChem (CID 155510008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).