C15H27N7O4 — CID 155510710
(2S)-2-[[(2S)-1-[(2S)-2,4-diaminobutanoyl]-2,5-dihydropyrrole-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 155510710) has the molecular formula C15H27N7O4 and a molecular weight of 369.43 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-[(2S)-2,4-diaminobutanoyl]-2,5-dihydropyrrole-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-[(2S)-2,4-diaminobutanoyl]-2,5-dihydropyrrole-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 155510710 |
| Molecular Formula | C15H27N7O4 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (2S)-2-[[(2S)-1-[(2S)-2,4-diaminobutanoyl]-2,5-dihydropyrrole-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCC[C@H](N)C(=O)N1CC=C[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C15H27N7O4/c16-6-5-9(17)13(24)22-8-2-4-11(22)12(23)21-10(14(25)26)3-1-7-20-15(18)19/h2,4,9-11H,1,3,5-8,16-17H2,(H,21,23)(H,25,26)(H4,18,19,20)/t9-,10-,11-/m0/s1 |
| InChIKey | GEPLKVZDENBTBW-DCAQKATOSA-N |
| XLogP | -2.95 |
| TPSA | 203.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|