C30H37NO7 — CID 155510731
(1R,2R)-1-(3,4-dimethoxyphenyl)-2-[4-[(3S)-1-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]-2-methoxyphenoxy]propan-1-ol (PubChem CID 155510731) has the molecular formula C30H37NO7 and a molecular weight of 523.63 g/mol. Its IUPAC name is (1R,2R)-1-(3,4-dimethoxyphenyl)-2-[4-[(3S)-1-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]-2-methoxyphenoxy]propan-1-ol.
| Compound Name | (1R,2R)-1-(3,4-dimethoxyphenyl)-2-[4-[(3S)-1-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]-2-methoxyphenoxy]propan-1-ol |
|---|---|
| PubChem CID | 155510731 |
| Molecular Formula | C30H37NO7 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | (1R,2R)-1-(3,4-dimethoxyphenyl)-2-[4-[(3S)-1-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]-2-methoxyphenoxy]propan-1-ol |
| SMILES | COc1ccc(C(O)[C@@H](C)Oc2ccc([C@@H]3CCN(c4ccc(OC)c(OC)c4)C3)cc2OC)cc1OC |
| InChI | InChI=1S/C30H37NO7/c1-19(30(32)21-8-10-24(33-2)27(16-21)35-4)38-26-11-7-20(15-28(26)36-5)22-13-14-31(18-22)23-9-12-25(34-3)29(17-23)37-6/h7-12,15-17,19,22,30,32H,13-14,18H2,1-6H3/t19-,22-,30?/m1/s1 |
| InChIKey | BUOGXUROHUPRLI-UUZAFOFNSA-N |
| XLogP | 5.22 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|