About N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide
N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide (PubChem CID 155510762) has the molecular formula C19H20N2O4
and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide |
| PubChem CID | 155510762 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NOCc2ccc(/C=C/C(=O)NO)cc2)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-13-9-14(2)11-17(10-13)19(23)21-25-12-16-5-3-15(4-6-16)7-8-18(22)20-24/h3-11,24H,12H2,1-2H3,(H,20,22)(H,21,23)/b8-7+ |
| InChIKey | VGPPKRFDCSZGRO-BQYQJAHWSA-N |
| XLogP | 2.68 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide?
The IUPAC name of N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide (CID 155510762) is N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide.
What is the SMILES notation for N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide?
The canonical SMILES for N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide is Cc1cc(C)cc(C(=O)NOCc2ccc(/C=C/C(=O)NO)cc2)c1.
What is the InChIKey of N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide?
The InChIKey is VGPPKRFDCSZGRO-BQYQJAHWSA-N. The full InChI is InChI=1S/C19H20N2O4/c1-13-9-14(2)11-17(10-13)19(23)21-25-12-16-5-3-15(4-6-16)7-8-18(22)20-24/h3-11,24H,12H2,1-2H3,(H,20,22)(H,21,23)/b8-7+.
What are the key properties of N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide?
N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide has a molecular weight of 340.38 g/mol, XLogP of 2.68, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methoxy]-3,5-dimethylbenzamide is sourced from PubChem (CID 155510762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).