C19H21NO — CID 155511171
(2R,4S,11bS)-4-phenyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol (PubChem CID 155511171) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (2R,4S,11bS)-4-phenyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol.
| Compound Name | (2R,4S,11bS)-4-phenyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 155511171 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (2R,4S,11bS)-4-phenyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
| SMILES | O[C@@H]1C[C@@H](c2ccccc2)N2CCc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C19H21NO/c21-16-12-18(15-7-2-1-3-8-15)20-11-10-14-6-4-5-9-17(14)19(20)13-16/h1-9,16,18-19,21H,10-13H2/t16-,18+,19+/m1/s1 |
| InChIKey | BPMKKJKTRYEWIS-NEWSRXKRSA-N |
| XLogP | 3.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |