C19H16N2O3S — CID 155511365
[4-(1,3-benzodioxol-5-yl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone (PubChem CID 155511365) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-yl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone.
| Compound Name | [4-(1,3-benzodioxol-5-yl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 155511365 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | [4-(1,3-benzodioxol-5-yl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone |
| SMILES | CC1=C(C(=O)c2ccccc2)C(c2ccc3c(c2)OCO3)NC(=S)N1 |
| InChI | InChI=1S/C19H16N2O3S/c1-11-16(18(22)12-5-3-2-4-6-12)17(21-19(25)20-11)13-7-8-14-15(9-13)24-10-23-14/h2-9,17H,10H2,1H3,(H2,20,21,25) |
| InChIKey | WJMINMLYWDSHSO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|