C31H39N2O13P — CID 155511370
benzyl 2-[[[(2R,3S,4R,5S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 155511370) has the molecular formula C31H39N2O13P and a molecular weight of 678.63 g/mol. Its IUPAC name is benzyl 2-[[[(2R,3S,4R,5S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | benzyl 2-[[[(2R,3S,4R,5S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 155511370 |
| Molecular Formula | C31H39N2O13P |
| Molecular Weight | 678.63 g/mol |
| Exact Mass | 678.22 |
| IUPAC Name | benzyl 2-[[[(2R,3S,4R,5S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | CC(=O)N[C@@H]1C(OC(C)=O)O[C@H](COP(=O)(NC(C)(C)C(=O)OCc2ccccc2)Oc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H39N2O13P/c1-19(34)32-26-28(43-21(3)36)27(42-20(2)35)25(45-29(26)44-22(4)37)18-41-47(39,46-24-15-11-8-12-16-24)33-31(5,6)30(38)40-17-23-13-9-7-10-14-23/h7-16,25-29H,17-18H2,1-6H3,(H,32,34)(H,33,39)/t25-,26+,27-,28-,29?,47?/m1/s1 |
| InChIKey | AYINCOJXCPSVJS-YJKWOCAXSA-N |
| XLogP | 2.96 |
| TPSA | 191.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.63 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|