C22H26N2O4 — CID 155511383
methyl (E)-2-[(2S,3R,7aR,12bR)-3-ethenyl-7a-hydroxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate (PubChem CID 155511383) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl (E)-2-[(2S,3R,7aR,12bR)-3-ethenyl-7a-hydroxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(2S,3R,7aR,12bR)-3-ethenyl-7a-hydroxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 155511383 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | methyl (E)-2-[(2S,3R,7aR,12bR)-3-ethenyl-7a-hydroxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
| SMILES | C=C[C@H]1CN2CC[C@]3(O)C(=Nc4ccccc43)[C@H]2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C22H26N2O4/c1-4-14-12-24-10-9-22(26)17-7-5-6-8-18(17)23-20(22)19(24)11-15(14)16(13-27-2)21(25)28-3/h4-8,13-15,19,26H,1,9-12H2,2-3H3/b16-13+/t14-,15-,19+,22+/m0/s1 |
| InChIKey | AWIMFNRKWCFEBE-BRSGZFOASA-N |
| XLogP | 2.56 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|