About 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol
4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol (PubChem CID 155511407) has the molecular formula C18H11F4NO2
and a molecular weight of 349.28 g/mol. Its IUPAC name is 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol.
Molecular Properties
| Compound Name | 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol |
| PubChem CID | 155511407 |
| Molecular Formula | C18H11F4NO2 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol |
| SMILES | Cc1ncc(-c2cc(F)c(O)c(F)c2)cc1-c1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C18H11F4NO2/c1-8-12(10-5-15(21)18(25)16(22)6-10)2-11(7-23-8)9-3-13(19)17(24)14(20)4-9/h2-7,24-25H,1H3 |
| InChIKey | PMRGRXLXKYUDIH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol?
The IUPAC name of 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol (CID 155511407) is 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol.
What is the SMILES notation for 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol?
The canonical SMILES for 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol is Cc1ncc(-c2cc(F)c(O)c(F)c2)cc1-c1cc(F)c(O)c(F)c1.
What is the InChIKey of 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol?
The InChIKey is PMRGRXLXKYUDIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F4NO2/c1-8-12(10-5-15(21)18(25)16(22)6-10)2-11(7-23-8)9-3-13(19)17(24)14(20)4-9/h2-7,24-25H,1H3.
What are the key properties of 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol?
4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol has a molecular weight of 349.28 g/mol, XLogP of 4.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol is sourced from PubChem (CID 155511407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).