C18H15ClN4S2 — CID 155511708
1-(3-chlorophenyl)-3-[[3-(2-cyclopropylethynyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]thiourea (PubChem CID 155511708) has the molecular formula C18H15ClN4S2 and a molecular weight of 386.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[3-(2-cyclopropylethynyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[[3-(2-cyclopropylethynyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 155511708 |
| Molecular Formula | C18H15ClN4S2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[3-(2-cyclopropylethynyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]thiourea |
| SMILES | S=C(NCc1cnc2scc(C#CC3CC3)n12)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15ClN4S2/c19-13-2-1-3-14(8-13)22-17(24)20-9-16-10-21-18-23(16)15(11-25-18)7-6-12-4-5-12/h1-3,8,10-12H,4-5,9H2,(H2,20,22,24) |
| InChIKey | WLRATFYHLBGJRT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|