C15H21BrFN6O4P — CID 155511770
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[4-[[methoxy(methyl)phosphoryl]amino]butylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155511770) has the molecular formula C15H21BrFN6O4P and a molecular weight of 479.25 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[4-[[methoxy(methyl)phosphoryl]amino]butylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[4-[[methoxy(methyl)phosphoryl]amino]butylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155511770 |
| Molecular Formula | C15H21BrFN6O4P |
| Molecular Weight | 479.25 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[4-[[methoxy(methyl)phosphoryl]amino]butylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | COP(C)(=O)NCCCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C15H21BrFN6O4P/c1-26-28(2,25)19-8-4-3-7-18-14-13(22-27-23-14)15(21-24)20-10-5-6-12(17)11(16)9-10/h5-6,9,24H,3-4,7-8H2,1-2H3,(H,18,23)(H,19,25)(H,20,21) |
| InChIKey | VPZIQYMEUIFNFK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|