C24H23F4N3O2 — CID 155511936
(E)-3-[4-[(6S,8R)-7-(2,2-difluoropropyl)-6,8-dimethyl-8,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-3,5-difluorophenyl]prop-2-enoic acid (PubChem CID 155511936) has the molecular formula C24H23F4N3O2 and a molecular weight of 461.46 g/mol. Its IUPAC name is (E)-3-[4-[(6S,8R)-7-(2,2-difluoropropyl)-6,8-dimethyl-8,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-3,5-difluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(6S,8R)-7-(2,2-difluoropropyl)-6,8-dimethyl-8,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-3,5-difluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155511936 |
| Molecular Formula | C24H23F4N3O2 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (E)-3-[4-[(6S,8R)-7-(2,2-difluoropropyl)-6,8-dimethyl-8,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-3,5-difluorophenyl]prop-2-enoic acid |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@](C)(c2c(F)cc(/C=C/C(=O)O)cc2F)N1CC(C)(F)F |
| InChI | InChI=1S/C24H23F4N3O2/c1-13-8-15-16-11-29-30-20(16)6-5-17(15)24(3,31(13)12-23(2,27)28)22-18(25)9-14(10-19(22)26)4-7-21(32)33/h4-7,9-11,13H,8,12H2,1-3H3,(H,29,30)(H,32,33)/b7-4+/t13-,24+/m1/s1 |
| InChIKey | MMXVAIMUFWTRCA-TYXYSXLUSA-N |
| XLogP | 5.10 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|