C20H27ClN2O3S — CID 155511962
1-(5-chloro-2,4-dimethoxyphenyl)-3-[2-(6-methyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-3-yl)ethyl]urea (PubChem CID 155511962) has the molecular formula C20H27ClN2O3S and a molecular weight of 410.97 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-[2-(6-methyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-3-yl)ethyl]urea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[2-(6-methyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 155511962 |
| Molecular Formula | C20H27ClN2O3S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[2-(6-methyl-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-3-yl)ethyl]urea |
| SMILES | COc1cc(OC)c(NC(=O)NCCC2=CSC3CC(C)CCC23)cc1Cl |
| InChI | InChI=1S/C20H27ClN2O3S/c1-12-4-5-14-13(11-27-19(14)8-12)6-7-22-20(24)23-16-9-15(21)17(25-2)10-18(16)26-3/h9-12,14,19H,4-8H2,1-3H3,(H2,22,23,24) |
| InChIKey | PRIPWHITKPWISS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |