C22H28N6O3 — CID 155511970
1-[(2-amino-4-pyridinyl)methyl]-1-(3,4-dimethoxyphenyl)-3-[3-(5-methylimidazol-1-yl)propyl]urea (PubChem CID 155511970) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 1-[(2-amino-4-pyridinyl)methyl]-1-(3,4-dimethoxyphenyl)-3-[3-(5-methylimidazol-1-yl)propyl]urea.
| Compound Name | 1-[(2-amino-4-pyridinyl)methyl]-1-(3,4-dimethoxyphenyl)-3-[3-(5-methylimidazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 155511970 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-[(2-amino-4-pyridinyl)methyl]-1-(3,4-dimethoxyphenyl)-3-[3-(5-methylimidazol-1-yl)propyl]urea |
| SMILES | COc1ccc(N(Cc2ccnc(N)c2)C(=O)NCCCn2cncc2C)cc1OC |
| InChI | InChI=1S/C22H28N6O3/c1-16-13-24-15-27(16)10-4-8-26-22(29)28(14-17-7-9-25-21(23)11-17)18-5-6-19(30-2)20(12-18)31-3/h5-7,9,11-13,15H,4,8,10,14H2,1-3H3,(H2,23,25)(H,26,29) |
| InChIKey | CNGRWVHOJPNCTB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|