C17H14N4S — CID 155512011
N-benzyl-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine (PubChem CID 155512011) has the molecular formula C17H14N4S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-benzyl-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine.
| Compound Name | N-benzyl-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 155512011 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-benzyl-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine |
| SMILES | c1ccc(CNc2ncc3c(n2)-c2cccnc2SC3)cc1 |
| InChI | InChI=1S/C17H14N4S/c1-2-5-12(6-3-1)9-19-17-20-10-13-11-22-16-14(15(13)21-17)7-4-8-18-16/h1-8,10H,9,11H2,(H,19,20,21) |
| InChIKey | MQRLHSZMEMLXNU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |