About 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide
5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide (PubChem CID 155512022) has the molecular formula C19H16N4O2
and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide |
| PubChem CID | 155512022 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccncc2)cc(C(=O)Nc2ccncc2)c1 |
| InChI | InChI=1S/C19H16N4O2/c1-13-10-14(18(24)22-16-2-6-20-7-3-16)12-15(11-13)19(25)23-17-4-8-21-9-5-17/h2-12H,1H3,(H,20,22,24)(H,21,23,25) |
| InChIKey | BPDNQOPIVDWLJJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide?
The IUPAC name of 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide (CID 155512022) is 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide.
What is the SMILES notation for 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide?
The canonical SMILES for 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide is Cc1cc(C(=O)Nc2ccncc2)cc(C(=O)Nc2ccncc2)c1.
What is the InChIKey of 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide?
The InChIKey is BPDNQOPIVDWLJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2/c1-13-10-14(18(24)22-16-2-6-20-7-3-16)12-15(11-13)19(25)23-17-4-8-21-9-5-17/h2-12H,1H3,(H,20,22,24)(H,21,23,25).
What are the key properties of 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide?
5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide has a molecular weight of 332.36 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-N,3-N-dipyridin-4-ylbenzene-1,3-dicarboxamide is sourced from PubChem (CID 155512022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).