C30H37N3O — CID 155512117
(E)-N-[5-[4-[[benzyl(propan-2-yl)amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 155512117) has the molecular formula C30H37N3O and a molecular weight of 455.65 g/mol. Its IUPAC name is (E)-N-[5-[4-[[benzyl(propan-2-yl)amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[4-[[benzyl(propan-2-yl)amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 155512117 |
| Molecular Formula | C30H37N3O |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | (E)-N-[5-[4-[[benzyl(propan-2-yl)amino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC(C)N(Cc1ccccc1)Cc1ccc(CCCCCNC(=O)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C30H37N3O/c1-25(2)33(23-28-11-5-3-6-12-28)24-29-16-14-26(15-17-29)10-7-4-8-21-32-30(34)19-18-27-13-9-20-31-22-27/h3,5-6,9,11-20,22,25H,4,7-8,10,21,23-24H2,1-2H3,(H,32,34)/b19-18+ |
| InChIKey | CCXHIHZRRUILIH-VHEBQXMUSA-N |
| XLogP | 6.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|