C20H22O8 — CID 155512126
(1S,2S,4R,10R,11S,15S)-11-hydroxy-4-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]-2,10-dimethyl-5,13-dioxatetracyclo[8.6.0.02,7.011,15]hexadec-7-ene-6,12-dione (PubChem CID 155512126) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is (1S,2S,4R,10R,11S,15S)-11-hydroxy-4-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]-2,10-dimethyl-5,13-dioxatetracyclo[8.6.0.02,7.011,15]hexadec-7-ene-6,12-dione.
| Compound Name | (1S,2S,4R,10R,11S,15S)-11-hydroxy-4-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]-2,10-dimethyl-5,13-dioxatetracyclo[8.6.0.02,7.011,15]hexadec-7-ene-6,12-dione |
|---|---|
| PubChem CID | 155512126 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (1S,2S,4R,10R,11S,15S)-11-hydroxy-4-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]-2,10-dimethyl-5,13-dioxatetracyclo[8.6.0.02,7.011,15]hexadec-7-ene-6,12-dione |
| SMILES | C[C@@]12C[C@H](C3=CC(=O)O[C@@H]3O)OC(=O)C1=CC[C@]1(C)[C@H]2C[C@H]2COC(=O)[C@]21O |
| InChI | InChI=1S/C20H22O8/c1-18-7-12(10-6-14(21)28-15(10)22)27-16(23)11(18)3-4-19(2)13(18)5-9-8-26-17(24)20(9,19)25/h3,6,9,12-13,15,22,25H,4-5,7-8H2,1-2H3/t9-,12+,13-,15-,18+,19+,20+/m0/s1 |
| InChIKey | IUQNWQHNLJDQRD-ILFWSXJFSA-N |
| XLogP | 0.37 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|