C24H34FNO16 — CID 155512191
methyl (3R,4R,5S,6R)-2,4-diacetyloxy-3-fluoro-5-(2-methoxyethoxycarbonylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 155512191) has the molecular formula C24H34FNO16 and a molecular weight of 611.52 g/mol. Its IUPAC name is methyl (3R,4R,5S,6R)-2,4-diacetyloxy-3-fluoro-5-(2-methoxyethoxycarbonylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (3R,4R,5S,6R)-2,4-diacetyloxy-3-fluoro-5-(2-methoxyethoxycarbonylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 155512191 |
| Molecular Formula | C24H34FNO16 |
| Molecular Weight | 611.52 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | methyl (3R,4R,5S,6R)-2,4-diacetyloxy-3-fluoro-5-(2-methoxyethoxycarbonylamino)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COCCOC(=O)N[C@H]1[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)OC(OC(C)=O)(C(=O)OC)[C@H](F)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H34FNO16/c1-11(27)37-10-16(38-12(2)28)18(39-13(3)29)19-17(26-23(33)36-9-8-34-6)20(40-14(4)30)21(25)24(42-19,22(32)35-7)41-15(5)31/h16-21H,8-10H2,1-7H3,(H,26,33)/t16-,17+,18-,19-,20-,21-,24?/m1/s1 |
| InChIKey | KHEZDNNFOWYZHT-ITOFLDEGSA-N |
| XLogP | -0.74 |
| TPSA | 214.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.52 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|