C21H24F2N2O2S — CID 155512234
N-[1-[(2,4-difluorophenyl)methyl]-2,3-dihydroindol-5-yl]cyclohexanesulfonamide (PubChem CID 155512234) has the molecular formula C21H24F2N2O2S and a molecular weight of 406.50 g/mol. Its IUPAC name is N-[1-[(2,4-difluorophenyl)methyl]-2,3-dihydroindol-5-yl]cyclohexanesulfonamide.
| Compound Name | N-[1-[(2,4-difluorophenyl)methyl]-2,3-dihydroindol-5-yl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 155512234 |
| Molecular Formula | C21H24F2N2O2S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[1-[(2,4-difluorophenyl)methyl]-2,3-dihydroindol-5-yl]cyclohexanesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)CCN2Cc1ccc(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C21H24F2N2O2S/c22-17-7-6-16(20(23)13-17)14-25-11-10-15-12-18(8-9-21(15)25)24-28(26,27)19-4-2-1-3-5-19/h6-9,12-13,19,24H,1-5,10-11,14H2 |
| InChIKey | CKIGGIUYPBRMLG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|