C27H18ClN5O3S — CID 155512329
4-[2-(4-chlorophenyl)imino-4-(2-oxochromen-3-yl)-1,3-thiazol-3-yl]-5-methyl-2-phenyl-1,2,4-triazol-3-one (PubChem CID 155512329) has the molecular formula C27H18ClN5O3S and a molecular weight of 527.99 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)imino-4-(2-oxochromen-3-yl)-1,3-thiazol-3-yl]-5-methyl-2-phenyl-1,2,4-triazol-3-one.
| Compound Name | 4-[2-(4-chlorophenyl)imino-4-(2-oxochromen-3-yl)-1,3-thiazol-3-yl]-5-methyl-2-phenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155512329 |
| Molecular Formula | C27H18ClN5O3S |
| Molecular Weight | 527.99 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | 4-[2-(4-chlorophenyl)imino-4-(2-oxochromen-3-yl)-1,3-thiazol-3-yl]-5-methyl-2-phenyl-1,2,4-triazol-3-one |
| SMILES | Cc1nn(-c2ccccc2)c(=O)n1-n1c(-c2cc3ccccc3oc2=O)cs/c1=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H18ClN5O3S/c1-17-30-31(21-8-3-2-4-9-21)27(35)32(17)33-23(16-37-26(33)29-20-13-11-19(28)12-14-20)22-15-18-7-5-6-10-24(18)36-25(22)34/h2-16H,1H3/b29-26- |
| InChIKey | WCSJLFVCZGEKFZ-WCTVFOPTSA-N |
| XLogP | 5.18 |
| TPSA | 87.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.99 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|