About 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one
2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one (PubChem CID 155512334) has the molecular formula C20H28N4O
and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one |
| PubChem CID | 155512334 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one |
| SMILES | CCCCC(CC)CN1C=NC2C(=O)NC(Cc3ccccc3)=NC21 |
| InChI | InChI=1S/C20H28N4O/c1-3-5-9-15(4-2)13-24-14-21-18-19(24)22-17(23-20(18)25)12-16-10-7-6-8-11-16/h6-8,10-11,14-15,18-19H,3-5,9,12-13H2,1-2H3,(H,22,23,25) |
| InChIKey | YEXJHPQKHOVSKT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one?
The IUPAC name of 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one (CID 155512334) is 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one.
What is the SMILES notation for 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one?
The canonical SMILES for 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one is CCCCC(CC)CN1C=NC2C(=O)NC(Cc3ccccc3)=NC21.
What is the InChIKey of 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one?
The InChIKey is YEXJHPQKHOVSKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O/c1-3-5-9-15(4-2)13-24-14-21-18-19(24)22-17(23-20(18)25)12-16-10-7-6-8-11-16/h6-8,10-11,14-15,18-19H,3-5,9,12-13H2,1-2H3,(H,22,23,25).
What are the key properties of 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one?
2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one has a molecular weight of 340.47 g/mol, XLogP of 3.01, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-9-(2-ethylhexyl)-4,5-dihydro-1H-purin-6-one is sourced from PubChem (CID 155512334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).