About 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine
5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine (PubChem CID 15551242) has the molecular formula C16H16N4O3
and a molecular weight of 312.33 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine |
| PubChem CID | 15551242 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine |
| SMILES | COc1ccc(Oc2cccc3nc(N)nc(N)c23)cc1OC |
| InChI | InChI=1S/C16H16N4O3/c1-21-11-7-6-9(8-13(11)22-2)23-12-5-3-4-10-14(12)15(17)20-16(18)19-10/h3-8H,1-2H3,(H4,17,18,19,20) |
| InChIKey | YBIRGKKOYUEYOL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine?
The IUPAC name of 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine (CID 15551242) is 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine.
What is the SMILES notation for 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine?
The canonical SMILES for 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine is COc1ccc(Oc2cccc3nc(N)nc(N)c23)cc1OC.
What is the InChIKey of 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine?
The InChIKey is YBIRGKKOYUEYOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O3/c1-21-11-7-6-9(8-13(11)22-2)23-12-5-3-4-10-14(12)15(17)20-16(18)19-10/h3-8H,1-2H3,(H4,17,18,19,20).
What are the key properties of 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine?
5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine has a molecular weight of 312.33 g/mol, XLogP of 2.60, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethoxyphenoxy)quinazoline-2,4-diamine is sourced from PubChem (CID 15551242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).