C23H26N2O — CID 155512477
(12aS)-7,7,9,12a-tetramethyl-2-prop-2-ynoxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline (PubChem CID 155512477) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is (12aS)-7,7,9,12a-tetramethyl-2-prop-2-ynoxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline.
| Compound Name | (12aS)-7,7,9,12a-tetramethyl-2-prop-2-ynoxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline |
|---|---|
| PubChem CID | 155512477 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (12aS)-7,7,9,12a-tetramethyl-2-prop-2-ynoxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline |
| SMILES | C#CCOc1ccc2c(c1)[C@@]1(C)Cc3cnc(C)nc3C(C)(C)C1CC2 |
| InChI | InChI=1S/C23H26N2O/c1-6-11-26-18-9-7-16-8-10-20-22(3,4)21-17(14-24-15(2)25-21)13-23(20,5)19(16)12-18/h1,7,9,12,14,20H,8,10-11,13H2,2-5H3/t20?,23-/m1/s1 |
| InChIKey | BIIQTNVKHZMCNZ-GWQXNCQPSA-N |
| XLogP | 4.15 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|