About N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine
N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine (PubChem CID 155512540) has the molecular formula C19H25ClN2O
and a molecular weight of 332.88 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine |
| PubChem CID | 155512540 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine |
| SMILES | COc1ccc(CCN(CCN(C)C)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H25ClN2O/c1-21(2)14-15-22(18-8-6-17(20)7-9-18)13-12-16-4-10-19(23-3)11-5-16/h4-11H,12-15H2,1-3H3 |
| InChIKey | SLIAUJGDCCTOIN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine?
The IUPAC name of N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine (CID 155512540) is N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine?
The canonical SMILES for N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine is COc1ccc(CCN(CCN(C)C)c2ccc(Cl)cc2)cc1.
What is the InChIKey of N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine?
The InChIKey is SLIAUJGDCCTOIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25ClN2O/c1-21(2)14-15-22(18-8-6-17(20)7-9-18)13-12-16-4-10-19(23-3)11-5-16/h4-11H,12-15H2,1-3H3.
What are the key properties of N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine?
N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine has a molecular weight of 332.88 g/mol, XLogP of 3.96, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-chlorophenyl)-N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylethane-1,2-diamine is sourced from PubChem (CID 155512540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).