C24H22Cl2N4O3S — CID 155512568
N-[2-[(3,4-dichlorophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide (PubChem CID 155512568) has the molecular formula C24H22Cl2N4O3S and a molecular weight of 517.44 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 155512568 |
| Molecular Formula | C24H22Cl2N4O3S |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(-c2cnc3[nH]ccc3c2)cc1)NCCNS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H22Cl2N4O3S/c25-21-7-6-20(14-22(21)26)34(32,33)30-12-11-27-23(31)8-3-16-1-4-17(5-2-16)19-13-18-9-10-28-24(18)29-15-19/h1-2,4-7,9-10,13-15,30H,3,8,11-12H2,(H,27,31)(H,28,29) |
| InChIKey | LQMSDUOEQAWTFX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|