C30H29ClF3N5O2 — CID 155512579
6-chloro-2-ethyl-N-[[4-[5-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 155512579) has the molecular formula C30H29ClF3N5O2 and a molecular weight of 584.04 g/mol. Its IUPAC name is 6-chloro-2-ethyl-N-[[4-[5-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-chloro-2-ethyl-N-[[4-[5-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155512579 |
| Molecular Formula | C30H29ClF3N5O2 |
| Molecular Weight | 584.04 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 6-chloro-2-ethyl-N-[[4-[5-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2ccc(Cl)cn2c1C(=O)NCc1ccc(N2CC3CN(c4ccc(OC(F)(F)F)cc4)CC3C2)cc1 |
| InChI | InChI=1S/C30H29ClF3N5O2/c1-2-26-28(39-18-22(31)5-12-27(39)36-26)29(40)35-13-19-3-6-23(7-4-19)37-14-20-16-38(17-21(20)15-37)24-8-10-25(11-9-24)41-30(32,33)34/h3-12,18,20-21H,2,13-17H2,1H3,(H,35,40) |
| InChIKey | CPXWYZNEKXFUEJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.04 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|