C26H36N8O6 — CID 155512611
(2S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[4-(3-carbamoylphenyl)butyl]amino]pentanoic acid (PubChem CID 155512611) has the molecular formula C26H36N8O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[4-(3-carbamoylphenyl)butyl]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[4-(3-carbamoylphenyl)butyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 155512611 |
| Molecular Formula | C26H36N8O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | (2S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[4-(3-carbamoylphenyl)butyl]amino]pentanoic acid |
| SMILES | NC(=O)c1cccc(CCCCN(CCC[C@H](N)C(=O)O)C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C26H36N8O6/c27-17(26(38)39)8-4-10-33(9-2-1-5-15-6-3-7-16(11-15)23(29)37)12-18-20(35)21(36)25(40-18)34-14-32-19-22(28)30-13-31-24(19)34/h3,6-7,11,13-14,17-18,20-21,25,35-36H,1-2,4-5,8-10,12,27H2,(H2,29,37)(H,38,39)(H2,28,30,31)/t17-,18+,20+,21+,25+/m0/s1 |
| InChIKey | PNULRDZZJLVMJS-PJBGZOMASA-N |
| XLogP | -0.36 |
| TPSA | 228.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|