C21H25F3N4O — CID 155512870
(3R,4S)-N-[(1S)-1-[4-(dimethylamino)phenyl]ethyl]-4-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide (PubChem CID 155512870) has the molecular formula C21H25F3N4O and a molecular weight of 406.45 g/mol. Its IUPAC name is (3R,4S)-N-[(1S)-1-[4-(dimethylamino)phenyl]ethyl]-4-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-[(1S)-1-[4-(dimethylamino)phenyl]ethyl]-4-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155512870 |
| Molecular Formula | C21H25F3N4O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (3R,4S)-N-[(1S)-1-[4-(dimethylamino)phenyl]ethyl]-4-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1CNC[C@@H]1c1ccc(C(F)(F)F)nc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H25F3N4O/c1-13(14-4-7-16(8-5-14)28(2)3)27-20(29)18-12-25-11-17(18)15-6-9-19(26-10-15)21(22,23)24/h4-10,13,17-18,25H,11-12H2,1-3H3,(H,27,29)/t13-,17+,18-/m0/s1 |
| InChIKey | WNUOARVONLZPJK-VHSSKADRSA-N |
| XLogP | 3.35 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|