C29H30N4O2 — CID 155513051
3-[3-cyclopropyl-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide (PubChem CID 155513051) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 3-[3-cyclopropyl-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 3-[3-cyclopropyl-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 155513051 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 3-[3-cyclopropyl-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide |
| SMILES | COc1ccc(-c2nc(C3CC3)nn2-c2cccc(C(=O)NCCCCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H30N4O2/c1-35-26-17-15-23(16-18-26)28-31-27(22-13-14-22)32-33(28)25-12-7-11-24(20-25)29(34)30-19-6-5-10-21-8-3-2-4-9-21/h2-4,7-9,11-12,15-18,20,22H,5-6,10,13-14,19H2,1H3,(H,30,34) |
| InChIKey | BZAXZUZBPBIEMJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|