About 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine
6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 155513136) has the molecular formula C18H11ClF2N4
and a molecular weight of 356.76 g/mol. Its IUPAC name is 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine.
Molecular Properties
| Compound Name | 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine |
| PubChem CID | 155513136 |
| Molecular Formula | C18H11ClF2N4 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | Fc1cc(F)c(-c2cc(Nc3ccncc3)c3cc[nH]c3n2)cc1Cl |
| InChI | InChI=1S/C18H11ClF2N4/c19-13-7-12(14(20)8-15(13)21)17-9-16(11-3-6-23-18(11)25-17)24-10-1-4-22-5-2-10/h1-9H,(H2,22,23,24,25) |
| InChIKey | MOXKDKRBVAMLRS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine?
The IUPAC name of 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine (CID 155513136) is 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine.
What is the SMILES notation for 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine?
The canonical SMILES for 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine is Fc1cc(F)c(-c2cc(Nc3ccncc3)c3cc[nH]c3n2)cc1Cl.
What is the InChIKey of 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine?
The InChIKey is MOXKDKRBVAMLRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11ClF2N4/c19-13-7-12(14(20)8-15(13)21)17-9-16(11-3-6-23-18(11)25-17)24-10-1-4-22-5-2-10/h1-9H,(H2,22,23,24,25).
What are the key properties of 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine?
6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine has a molecular weight of 356.76 g/mol, XLogP of 5.30, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-chloro-2,4-difluorophenyl)-N-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-amine is sourced from PubChem (CID 155513136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).