C30H24O10 — CID 155513164
(2,4-dihydroxyphenyl)-[(1R,2S,3S,4S)-3,4,6,7-tetrahydroxy-3-(4-hydroxybenzoyl)-1-(4-hydroxyphenyl)-2,4-dihydro-1H-naphthalen-2-yl]methanone (PubChem CID 155513164) has the molecular formula C30H24O10 and a molecular weight of 544.51 g/mol. Its IUPAC name is (2,4-dihydroxyphenyl)-[(1R,2S,3S,4S)-3,4,6,7-tetrahydroxy-3-(4-hydroxybenzoyl)-1-(4-hydroxyphenyl)-2,4-dihydro-1H-naphthalen-2-yl]methanone.
| Compound Name | (2,4-dihydroxyphenyl)-[(1R,2S,3S,4S)-3,4,6,7-tetrahydroxy-3-(4-hydroxybenzoyl)-1-(4-hydroxyphenyl)-2,4-dihydro-1H-naphthalen-2-yl]methanone |
|---|---|
| PubChem CID | 155513164 |
| Molecular Formula | C30H24O10 |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | (2,4-dihydroxyphenyl)-[(1R,2S,3S,4S)-3,4,6,7-tetrahydroxy-3-(4-hydroxybenzoyl)-1-(4-hydroxyphenyl)-2,4-dihydro-1H-naphthalen-2-yl]methanone |
| SMILES | O=C(c1ccc(O)cc1O)[C@H]1[C@H](c2ccc(O)cc2)c2cc(O)c(O)cc2[C@H](O)[C@]1(O)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H24O10/c31-16-5-1-14(2-6-16)25-20-12-23(35)24(36)13-21(20)29(39)30(40,28(38)15-3-7-17(32)8-4-15)26(25)27(37)19-10-9-18(33)11-22(19)34/h1-13,25-26,29,31-36,39-40H/t25-,26-,29+,30-/m1/s1 |
| InChIKey | SAGAVEAZOJMRGU-SXBXJLEOSA-N |
| XLogP | 3.21 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|