C29H35N5O3 — CID 155513203
N-[1-[4-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]phenyl]ethyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 155513203) has the molecular formula C29H35N5O3 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-[1-[4-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]phenyl]ethyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[1-[4-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]phenyl]ethyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155513203 |
| Molecular Formula | C29H35N5O3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | N-[1-[4-[[(2S)-1-amino-4-cyclohexyl-1-oxobutan-2-yl]carbamoyl]phenyl]ethyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | CC(NC(=O)c1cnn(-c2ccccc2)c1)c1ccc(C(=O)N[C@@H](CCC2CCCCC2)C(N)=O)cc1 |
| InChI | InChI=1S/C29H35N5O3/c1-20(32-29(37)24-18-31-34(19-24)25-10-6-3-7-11-25)22-13-15-23(16-14-22)28(36)33-26(27(30)35)17-12-21-8-4-2-5-9-21/h3,6-7,10-11,13-16,18-21,26H,2,4-5,8-9,12,17H2,1H3,(H2,30,35)(H,32,37)(H,33,36)/t20?,26-/m0/s1 |
| InChIKey | RYEFPWKRHLKVLM-GHZUAHJPSA-N |
| XLogP | 4.31 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |