About N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine
N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine (PubChem CID 155513308) has the molecular formula C16H9F6N3
and a molecular weight of 357.26 g/mol. Its IUPAC name is N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine.
Molecular Properties
| Compound Name | N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine |
| PubChem CID | 155513308 |
| Molecular Formula | C16H9F6N3 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine |
| SMILES | FC(F)(F)c1cc(Nc2ccncc2)c2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C16H9F6N3/c17-15(18,19)11-3-1-2-10-12(24-9-4-6-23-7-5-9)8-13(16(20,21)22)25-14(10)11/h1-8H,(H,23,24,25) |
| InChIKey | WQZSHPSNLYJVDC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine?
The IUPAC name of N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine (CID 155513308) is N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine.
What is the SMILES notation for N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine?
The canonical SMILES for N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine is FC(F)(F)c1cc(Nc2ccncc2)c2cccc(C(F)(F)F)c2n1.
What is the InChIKey of N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine?
The InChIKey is WQZSHPSNLYJVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9F6N3/c17-15(18,19)11-3-1-2-10-12(24-9-4-6-23-7-5-9)8-13(16(20,21)22)25-14(10)11/h1-8H,(H,23,24,25).
What are the key properties of N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine?
N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine has a molecular weight of 357.26 g/mol, XLogP of 5.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyridin-4-yl-2,8-bis(trifluoromethyl)quinolin-4-amine is sourced from PubChem (CID 155513308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).