About N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide
N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide (PubChem CID 155513310) has the molecular formula C23H20N4O3
and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide |
| PubChem CID | 155513310 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cn2c(=O)oc3ccccc32)cc1)N1CC(c2cccnc2)C1 |
| InChI | InChI=1S/C23H20N4O3/c28-22(26-14-18(15-26)17-4-3-11-24-12-17)25-19-9-7-16(8-10-19)13-27-20-5-1-2-6-21(20)30-23(27)29/h1-12,18H,13-15H2,(H,25,28) |
| InChIKey | QIWYLLHKVJJJGA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide?
The IUPAC name of N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide (CID 155513310) is N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide.
What is the SMILES notation for N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide?
The canonical SMILES for N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide is O=C(Nc1ccc(Cn2c(=O)oc3ccccc32)cc1)N1CC(c2cccnc2)C1.
What is the InChIKey of N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide?
The InChIKey is QIWYLLHKVJJJGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O3/c28-22(26-14-18(15-26)17-4-3-11-24-12-17)25-19-9-7-16(8-10-19)13-27-20-5-1-2-6-21(20)30-23(27)29/h1-12,18H,13-15H2,(H,25,28).
What are the key properties of N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide?
N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide has a molecular weight of 400.44 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide is sourced from PubChem (CID 155513310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).